C32H34F2N2O2 — CID 10142578
(4R)-4-(3,4-difluorophenyl)-3-(6-spiro[fluorene-9,4'-piperidine]-1'-ylhexyl)-1,3-oxazolidin-2-one (PubChem CID 10142578) has the molecular formula C32H34F2N2O2 and a molecular weight of 516.63 g/mol. Its IUPAC name is (4R)-4-(3,4-difluorophenyl)-3-(6-spiro[fluorene-9,4'-piperidine]-1'-ylhexyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(3,4-difluorophenyl)-3-(6-spiro[fluorene-9,4'-piperidine]-1'-ylhexyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10142578 |
| Molecular Formula | C32H34F2N2O2 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (4R)-4-(3,4-difluorophenyl)-3-(6-spiro[fluorene-9,4'-piperidine]-1'-ylhexyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccc(F)c(F)c2)N1CCCCCCN1CCC2(CC1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C32H34F2N2O2/c33-28-14-13-23(21-29(28)34)30-22-38-31(37)36(30)18-8-2-1-7-17-35-19-15-32(16-20-35)26-11-5-3-9-24(26)25-10-4-6-12-27(25)32/h3-6,9-14,21,30H,1-2,7-8,15-20,22H2/t30-/m0/s1 |
| InChIKey | MJOOYXLPHHNZNI-PMERELPUSA-N |
| XLogP | 7.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|