C23H28F2N4O3S — CID 139908159
1-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]-3-[3-[4-(5-methylthiophen-2-yl)piperidin-1-yl]propyl]urea (PubChem CID 139908159) has the molecular formula C23H28F2N4O3S and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]-3-[3-[4-(5-methylthiophen-2-yl)piperidin-1-yl]propyl]urea.
| Compound Name | 1-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]-3-[3-[4-(5-methylthiophen-2-yl)piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 139908159 |
| Molecular Formula | C23H28F2N4O3S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]-3-[3-[4-(5-methylthiophen-2-yl)piperidin-1-yl]propyl]urea |
| SMILES | Cc1ccc(C2CCN(CCCNC(=O)NN3C(=O)OCC3c3ccc(F)c(F)c3)CC2)s1 |
| InChI | InChI=1S/C23H28F2N4O3S/c1-15-3-6-21(33-15)16-7-11-28(12-8-16)10-2-9-26-22(30)27-29-20(14-32-23(29)31)17-4-5-18(24)19(25)13-17/h3-6,13,16,20H,2,7-12,14H2,1H3,(H2,26,27,30) |
| InChIKey | RZHMCKIFAGFSFF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|