C30H29F2N3O3S — CID 18740743
4-(3,4-difluorophenyl)-2-oxo-N-(3-spiro[piperidine-4,9'-thioxanthene]-1-ylpropyl)-1,3-oxazolidine-3-carboxamide (PubChem CID 18740743) has the molecular formula C30H29F2N3O3S and a molecular weight of 549.64 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-oxo-N-(3-spiro[piperidine-4,9'-thioxanthene]-1-ylpropyl)-1,3-oxazolidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-2-oxo-N-(3-spiro[piperidine-4,9'-thioxanthene]-1-ylpropyl)-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 18740743 |
| Molecular Formula | C30H29F2N3O3S |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-oxo-N-(3-spiro[piperidine-4,9'-thioxanthene]-1-ylpropyl)-1,3-oxazolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCC2(CC1)c1ccccc1Sc1ccccc12)N1C(=O)OCC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C30H29F2N3O3S/c31-23-11-10-20(18-24(23)32)25-19-38-29(37)35(25)28(36)33-14-5-15-34-16-12-30(13-17-34)21-6-1-3-8-26(21)39-27-9-4-2-7-22(27)30/h1-4,6-11,18,25H,5,12-17,19H2,(H,33,36) |
| InChIKey | FPRQZBXRHMCLBM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|