C21H31F2N3O2 — CID 22977444
3-(3,4-difluorophenyl)-N-[3-(4,4-dimethylpiperidin-1-yl)propyl]morpholine-4-carboxamide (PubChem CID 22977444) has the molecular formula C21H31F2N3O2 and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[3-(4,4-dimethylpiperidin-1-yl)propyl]morpholine-4-carboxamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[3-(4,4-dimethylpiperidin-1-yl)propyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 22977444 |
| Molecular Formula | C21H31F2N3O2 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[3-(4,4-dimethylpiperidin-1-yl)propyl]morpholine-4-carboxamide |
| SMILES | CC1(C)CCN(CCCNC(=O)N2CCOCC2c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H31F2N3O2/c1-21(2)6-10-25(11-7-21)9-3-8-24-20(27)26-12-13-28-15-19(26)16-4-5-17(22)18(23)14-16/h4-5,14,19H,3,6-13,15H2,1-2H3,(H,24,27) |
| InChIKey | PYPMLEUQTPGHCA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|