C25H29F2N3O5S — CID 18789781
4-(3,4-difluorophenyl)-N-[2-[(4-methylsulfonyl-4-phenylcyclohexyl)amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide (PubChem CID 18789781) has the molecular formula C25H29F2N3O5S and a molecular weight of 521.59 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-[2-[(4-methylsulfonyl-4-phenylcyclohexyl)amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-N-[2-[(4-methylsulfonyl-4-phenylcyclohexyl)amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 18789781 |
| Molecular Formula | C25H29F2N3O5S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-[2-[(4-methylsulfonyl-4-phenylcyclohexyl)amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
| SMILES | CS(=O)(=O)C1(c2ccccc2)CCC(NCCNC(=O)N2C(=O)OCC2c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H29F2N3O5S/c1-36(33,34)25(18-5-3-2-4-6-18)11-9-19(10-12-25)28-13-14-29-23(31)30-22(16-35-24(30)32)17-7-8-20(26)21(27)15-17/h2-8,15,19,22,28H,9-14,16H2,1H3,(H,29,31) |
| InChIKey | PJXYPBFNQDDQEI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|