C25H25F3N4O3 — CID 54465196
N-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide (PubChem CID 54465196) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is N-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide.
| Compound Name | N-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 54465196 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide |
| SMILES | N#CC1(c2ccccc2)CCC(NCCNC(=O)N2C(=O)OCC2c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H25F3N4O3/c26-19-12-16(13-20(27)22(19)28)21-14-35-24(34)32(21)23(33)31-11-10-30-18-6-8-25(15-29,9-7-18)17-4-2-1-3-5-17/h1-5,12-13,18,21,30H,6-11,14H2,(H,31,33) |
| InChIKey | XEIUADLUHYGLSO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|