C29H31F2N5O5 — CID 91576771
methyl 1-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethylcarbamoyl]-6-(3,4-difluorophenyl)-4-formyl-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 91576771) has the molecular formula C29H31F2N5O5 and a molecular weight of 567.59 g/mol. Its IUPAC name is methyl 1-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethylcarbamoyl]-6-(3,4-difluorophenyl)-4-formyl-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | methyl 1-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethylcarbamoyl]-6-(3,4-difluorophenyl)-4-formyl-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 91576771 |
| Molecular Formula | C29H31F2N5O5 |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | methyl 1-[2-[(4-cyano-4-phenylcyclohexyl)amino]ethylcarbamoyl]-6-(3,4-difluorophenyl)-4-formyl-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | COC(=O)C1C(C=O)NC(=O)N(C(=O)NCCNC2CCC(C#N)(c3ccccc3)CC2)C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C29H31F2N5O5/c1-41-26(38)24-23(16-37)35-28(40)36(25(24)18-7-8-21(30)22(31)15-18)27(39)34-14-13-33-20-9-11-29(17-32,12-10-20)19-5-3-2-4-6-19/h2-8,15-16,20,23-25,33H,9-14H2,1H3,(H,34,39)(H,35,40) |
| InChIKey | SQYXQMWGLXDHEM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|