C28H33F3N4O4 — CID 22049486
N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide (PubChem CID 22049486) has the molecular formula C28H33F3N4O4 and a molecular weight of 546.59 g/mol. Its IUPAC name is N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide.
| Compound Name | N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 22049486 |
| Molecular Formula | C28H33F3N4O4 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]-2-oxo-4-(3,4,5-trifluorophenyl)-1,3-oxazolidine-3-carboxamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCNC(=O)N3C(=O)OCC3c3cc(F)c(F)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C28H33F3N4O4/c1-17(2)26(36)33-21-6-3-5-19(13-21)18-7-11-34(12-8-18)10-4-9-32-27(37)35-24(16-39-28(35)38)20-14-22(29)25(31)23(30)15-20/h3,5-6,13-15,17-18,24H,4,7-12,16H2,1-2H3,(H,32,37)(H,33,36) |
| InChIKey | QNLVKERVAUXOLH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|