C28H38ClN3O2 — CID 10458014
2-(4-chlorophenyl)-2-methyl-N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]propanamide (PubChem CID 10458014) has the molecular formula C28H38ClN3O2 and a molecular weight of 484.08 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]propanamide.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 10458014 |
| Molecular Formula | C28H38ClN3O2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-N-[3-[4-[3-(2-methylpropanoylamino)phenyl]piperidin-1-yl]propyl]propanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCNC(=O)C(C)(C)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C28H38ClN3O2/c1-20(2)26(33)31-25-8-5-7-22(19-25)21-13-17-32(18-14-21)16-6-15-30-27(34)28(3,4)23-9-11-24(29)12-10-23/h5,7-12,19-21H,6,13-18H2,1-4H3,(H,30,34)(H,31,33) |
| InChIKey | RDWOBOZVCKVJQR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|