C32H38BrClN2O2 — CID 22048947
N-[3-[1-[5-(4-bromophenoxy)-5-(4-chlorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22048947) has the molecular formula C32H38BrClN2O2 and a molecular weight of 598.03 g/mol. Its IUPAC name is N-[3-[1-[5-(4-bromophenoxy)-5-(4-chlorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-(4-bromophenoxy)-5-(4-chlorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22048947 |
| Molecular Formula | C32H38BrClN2O2 |
| Molecular Weight | 598.03 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | N-[3-[1-[5-(4-bromophenoxy)-5-(4-chlorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCC(Oc3ccc(Br)cc3)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C32H38BrClN2O2/c1-23(2)32(37)35-29-7-5-6-26(22-29)24-17-20-36(21-18-24)19-4-3-8-31(25-9-13-28(34)14-10-25)38-30-15-11-27(33)12-16-30/h5-7,9-16,22-24,31H,3-4,8,17-21H2,1-2H3,(H,35,37) |
| InChIKey | RAQISMKRINODGW-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.03 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|