C35H43FN2O3 — CID 22049438
N-[3-[1-[6-(3-acetylphenoxy)-6-(2-fluorophenyl)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049438) has the molecular formula C35H43FN2O3 and a molecular weight of 558.74 g/mol. Its IUPAC name is N-[3-[1-[6-(3-acetylphenoxy)-6-(2-fluorophenyl)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[6-(3-acetylphenoxy)-6-(2-fluorophenyl)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049438 |
| Molecular Formula | C35H43FN2O3 |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | N-[3-[1-[6-(3-acetylphenoxy)-6-(2-fluorophenyl)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(=O)c1cccc(OC(CCCCCN2CCC(c3cccc(NC(=O)C(C)C)c3)CC2)c2ccccc2F)c1 |
| InChI | InChI=1S/C35H43FN2O3/c1-25(2)35(40)37-30-13-9-12-29(23-30)27-18-21-38(22-19-27)20-8-4-5-17-34(32-15-6-7-16-33(32)36)41-31-14-10-11-28(24-31)26(3)39/h6-7,9-16,23-25,27,34H,4-5,8,17-22H2,1-3H3,(H,37,40) |
| InChIKey | WAXWVZBJEDHHJF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|