C29H33FN2O2 — CID 22049370
N-[3-[1-[2-(4-fluorophenoxy)-2-phenylethyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049370) has the molecular formula C29H33FN2O2 and a molecular weight of 460.59 g/mol. Its IUPAC name is N-[3-[1-[2-(4-fluorophenoxy)-2-phenylethyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[2-(4-fluorophenoxy)-2-phenylethyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049370 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[3-[1-[2-(4-fluorophenoxy)-2-phenylethyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CC(Oc3ccc(F)cc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H33FN2O2/c1-21(2)29(33)31-26-10-6-9-24(19-26)22-15-17-32(18-16-22)20-28(23-7-4-3-5-8-23)34-27-13-11-25(30)12-14-27/h3-14,19,21-22,28H,15-18,20H2,1-2H3,(H,31,33) |
| InChIKey | BBQPUAAAGFHFQI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |