C33H41FN2O2 — CID 22048856
N-[3-[1-[6-(4-fluorophenoxy)-6-phenylhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22048856) has the molecular formula C33H41FN2O2 and a molecular weight of 516.70 g/mol. Its IUPAC name is N-[3-[1-[6-(4-fluorophenoxy)-6-phenylhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[6-(4-fluorophenoxy)-6-phenylhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22048856 |
| Molecular Formula | C33H41FN2O2 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | N-[3-[1-[6-(4-fluorophenoxy)-6-phenylhexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCCC(Oc3ccc(F)cc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C33H41FN2O2/c1-25(2)33(37)35-30-13-9-12-28(24-30)26-19-22-36(23-20-26)21-8-4-7-14-32(27-10-5-3-6-11-27)38-31-17-15-29(34)16-18-31/h3,5-6,9-13,15-18,24-26,32H,4,7-8,14,19-23H2,1-2H3,(H,35,37) |
| InChIKey | MROYVSGKJPHVNK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|