C39H46N4O6 — CID 91214368
3-O-ethyl 5-O-methyl 2-[3-(4,4-diphenylpiperidin-1-yl)propyliminomethyl]-6-ethyl-4-(4-nitrophenyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 91214368) has the molecular formula C39H46N4O6 and a molecular weight of 666.82 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-[3-(4,4-diphenylpiperidin-1-yl)propyliminomethyl]-6-ethyl-4-(4-nitrophenyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-[3-(4,4-diphenylpiperidin-1-yl)propyliminomethyl]-6-ethyl-4-(4-nitrophenyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91214368 |
| Molecular Formula | C39H46N4O6 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-[3-(4,4-diphenylpiperidin-1-yl)propyliminomethyl]-6-ethyl-4-(4-nitrophenyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(/C=N/CCCN2CCC(c3ccccc3)(c3ccccc3)CC2)N=C(CC)C(C(=O)OC)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C39H46N4O6/c1-4-32-35(37(44)48-3)34(28-17-19-31(20-18-28)43(46)47)36(38(45)49-5-2)33(41-32)27-40-23-12-24-42-25-21-39(22-26-42,29-13-8-6-9-14-29)30-15-10-7-11-16-30/h6-11,13-20,27,33-36H,4-5,12,21-26H2,1-3H3/b40-27+ |
| InChIKey | RWNSDGPBGFQJTD-WOQJSSNBSA-N |
| XLogP | 6.42 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|