C33H38N6O8 — CID 57058989
2-cyanoethyl 4-[ethyl-[4-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)butanoyl]amino]-6-(4-nitrophenyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 57058989) has the molecular formula C33H38N6O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is 2-cyanoethyl 4-[ethyl-[4-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)butanoyl]amino]-6-(4-nitrophenyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-cyanoethyl 4-[ethyl-[4-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)butanoyl]amino]-6-(4-nitrophenyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 57058989 |
| Molecular Formula | C33H38N6O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 2-cyanoethyl 4-[ethyl-[4-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)butanoyl]amino]-6-(4-nitrophenyl)-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCN(C(=O)CCCN1CCC(C(=O)OC)(c2ccccc2)CC1)C1=NC(=O)NC(c2ccc([N+](=O)[O-])cc2)C1C(=O)OCCC#N |
| InChI | InChI=1S/C33H38N6O8/c1-3-38(26(40)11-7-19-37-20-16-33(17-21-37,31(42)46-2)24-9-5-4-6-10-24)29-27(30(41)47-22-8-18-34)28(35-32(43)36-29)23-12-14-25(15-13-23)39(44)45/h4-6,9-10,12-15,27-28H,3,7-8,11,16-17,19-22H2,1-2H3,(H,35,43) |
| InChIKey | HSELKTHFHUHSPG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 184.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|