C18H25N3O2 — CID 10591445
2-cyanoethyl 1-(3-aminopropyl)-4-phenylpiperidine-4-carboxylate (PubChem CID 10591445) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-cyanoethyl 1-(3-aminopropyl)-4-phenylpiperidine-4-carboxylate.
| Compound Name | 2-cyanoethyl 1-(3-aminopropyl)-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 10591445 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-cyanoethyl 1-(3-aminopropyl)-4-phenylpiperidine-4-carboxylate |
| SMILES | N#CCCOC(=O)C1(c2ccccc2)CCN(CCCN)CC1 |
| InChI | InChI=1S/C18H25N3O2/c19-10-4-12-21-13-8-18(9-14-21,16-6-2-1-3-7-16)17(22)23-15-5-11-20/h1-3,6-7H,4-5,8-10,12-15,19H2 |
| InChIKey | OKDYFAJYBCIODJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|