C18H26ClNO3 — CID 138398169
ethyl 1-(3-oxobutyl)-4-phenylpiperidine-4-carboxylate;hydrochloride (PubChem CID 138398169) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is ethyl 1-(3-oxobutyl)-4-phenylpiperidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-(3-oxobutyl)-4-phenylpiperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 138398169 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 1-(3-oxobutyl)-4-phenylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCC(C)=O)CC1.Cl |
| InChI | InChI=1S/C18H25NO3.ClH/c1-3-22-17(21)18(16-7-5-4-6-8-16)10-13-19(14-11-18)12-9-15(2)20;/h4-8H,3,9-14H2,1-2H3;1H |
| InChIKey | OWBPFWBYDKXVLI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |