C20H30N2O3 — CID 20833920
ethyl 1-(2-morpholin-2-ylethyl)-4-phenylpiperidine-4-carboxylate (PubChem CID 20833920) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl 1-(2-morpholin-2-ylethyl)-4-phenylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-morpholin-2-ylethyl)-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 20833920 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | ethyl 1-(2-morpholin-2-ylethyl)-4-phenylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCC2CNCCO2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-2-24-19(23)20(17-6-4-3-5-7-17)9-13-22(14-10-20)12-8-18-16-21-11-15-25-18/h3-7,18,21H,2,8-16H2,1H3 |
| InChIKey | FEAJPNPROVTELL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |