C26H34BrNO2 — CID 138396780
ethyl 4-phenyl-1-(1-phenylcyclohexyl)piperidine-4-carboxylate;hydrobromide (PubChem CID 138396780) has the molecular formula C26H34BrNO2 and a molecular weight of 472.47 g/mol. Its IUPAC name is ethyl 4-phenyl-1-(1-phenylcyclohexyl)piperidine-4-carboxylate;hydrobromide.
| Compound Name | ethyl 4-phenyl-1-(1-phenylcyclohexyl)piperidine-4-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 138396780 |
| Molecular Formula | C26H34BrNO2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | ethyl 4-phenyl-1-(1-phenylcyclohexyl)piperidine-4-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)C1(c2ccccc2)CCN(C2(c3ccccc3)CCCCC2)CC1 |
| InChI | InChI=1S/C26H33NO2.BrH/c1-2-29-24(28)25(22-12-6-3-7-13-22)18-20-27(21-19-25)26(16-10-5-11-17-26)23-14-8-4-9-15-23;/h3-4,6-9,12-15H,2,5,10-11,16-21H2,1H3;1H |
| InChIKey | OLPHDIMRHSRJLO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |