C14H19N — CID 101053650
(8aR)-8a-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine (PubChem CID 101053650) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (8aR)-8a-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine.
| Compound Name | (8aR)-8a-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 101053650 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (8aR)-8a-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine |
| SMILES | c1ccc([C@]23CCCCN2CCC3)cc1 |
| InChI | InChI=1S/C14H19N/c1-2-7-13(8-3-1)14-9-4-5-11-15(14)12-6-10-14/h1-3,7-8H,4-6,9-12H2/t14-/m1/s1 |
| InChIKey | AFZADFHTABDZSJ-CQSZACIVSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |