C27H40N2 — CID 68763740
(2S)-N-methyl-1-phenylpropan-2-amine;1-(1-phenylcyclohexyl)piperidine (PubChem CID 68763740) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is (2S)-N-methyl-1-phenylpropan-2-amine;1-(1-phenylcyclohexyl)piperidine.
| Compound Name | (2S)-N-methyl-1-phenylpropan-2-amine;1-(1-phenylcyclohexyl)piperidine |
|---|---|
| PubChem CID | 68763740 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | (2S)-N-methyl-1-phenylpropan-2-amine;1-(1-phenylcyclohexyl)piperidine |
| SMILES | CN[C@@H](C)Cc1ccccc1.c1ccc(C2(N3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N.C10H15N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(11-2)8-10-6-4-3-5-7-10/h1,4-5,10-11H,2-3,6-9,12-15H2;3-7,9,11H,8H2,1-2H3/t;9-/m.0/s1 |
| InChIKey | RHHKYWDRBFIMJF-NPULLEENSA-N |
| XLogP | 6.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |