C18H25N — CID 174875624
(2S)-N-methyl-1-phenylpropan-2-amine;1,4-xylene (PubChem CID 174875624) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is (2S)-N-methyl-1-phenylpropan-2-amine;1,4-xylene.
| Compound Name | (2S)-N-methyl-1-phenylpropan-2-amine;1,4-xylene |
|---|---|
| PubChem CID | 174875624 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (2S)-N-methyl-1-phenylpropan-2-amine;1,4-xylene |
| SMILES | CN[C@@H](C)Cc1ccccc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H15N.C8H10/c1-9(11-2)8-10-6-4-3-5-7-10;1-7-3-5-8(2)6-4-7/h3-7,9,11H,8H2,1-2H3;3-6H,1-2H3/t9-;/m0./s1 |
| InChIKey | YWONKDREFZUABW-FVGYRXGTSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |