C14H26FNO2S — CID 143236357
1-fluoropropane;methanesulfinic acid;N-methyl-1-phenylpropan-2-amine (PubChem CID 143236357) has the molecular formula C14H26FNO2S and a molecular weight of 291.43 g/mol. Its IUPAC name is 1-fluoropropane;methanesulfinic acid;N-methyl-1-phenylpropan-2-amine.
| Compound Name | 1-fluoropropane;methanesulfinic acid;N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 143236357 |
| Molecular Formula | C14H26FNO2S |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-fluoropropane;methanesulfinic acid;N-methyl-1-phenylpropan-2-amine |
| SMILES | CCCF.CNC(C)Cc1ccccc1.CS(=O)O |
| InChI | InChI=1S/C10H15N.C3H7F.CH4O2S/c1-9(11-2)8-10-6-4-3-5-7-10;1-2-3-4;1-4(2)3/h3-7,9,11H,8H2,1-2H3;2-3H2,1H3;1H3,(H,2,3) |
| InChIKey | PSBKVZWSGIPIEM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|