About potassium;hydride;N-methyl-1-phenylpropan-2-amine
potassium;hydride;N-methyl-1-phenylpropan-2-amine (PubChem CID 175165101) has the molecular formula C10H16KN
and a molecular weight of 189.34 g/mol. Its IUPAC name is potassium;hydride;N-methyl-1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | potassium;hydride;N-methyl-1-phenylpropan-2-amine |
| PubChem CID | 175165101 |
| Molecular Formula | C10H16KN |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | potassium;hydride;N-methyl-1-phenylpropan-2-amine |
| SMILES | CNC(C)Cc1ccccc1.[H-].[K+] |
| InChI | InChI=1S/C10H15N.K.H/c1-9(11-2)8-10-6-4-3-5-7-10;;/h3-7,9,11H,8H2,1-2H3;;/q;+1;-1 |
| InChIKey | KGDUDNKGLGKISB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;hydride;N-methyl-1-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;N-methyl-1-phenylpropan-2-amine?
The IUPAC name of potassium;hydride;N-methyl-1-phenylpropan-2-amine (CID 175165101) is potassium;hydride;N-methyl-1-phenylpropan-2-amine.
What is the SMILES notation for potassium;hydride;N-methyl-1-phenylpropan-2-amine?
The canonical SMILES for potassium;hydride;N-methyl-1-phenylpropan-2-amine is CNC(C)Cc1ccccc1.[H-].[K+].
What is the InChIKey of potassium;hydride;N-methyl-1-phenylpropan-2-amine?
The InChIKey is KGDUDNKGLGKISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.K.H/c1-9(11-2)8-10-6-4-3-5-7-10;;/h3-7,9,11H,8H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;hydride;N-methyl-1-phenylpropan-2-amine?
potassium;hydride;N-methyl-1-phenylpropan-2-amine has a molecular weight of 189.34 g/mol, XLogP of -1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;N-methyl-1-phenylpropan-2-amine is sourced from PubChem (CID 175165101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).