C12H22NO4P — CID 69021871
ethyl dihydrogen phosphate;N-methyl-1-phenylpropan-2-amine (PubChem CID 69021871) has the molecular formula C12H22NO4P and a molecular weight of 275.29 g/mol. Its IUPAC name is ethyl dihydrogen phosphate;N-methyl-1-phenylpropan-2-amine.
| Compound Name | ethyl dihydrogen phosphate;N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 69021871 |
| Molecular Formula | C12H22NO4P |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl dihydrogen phosphate;N-methyl-1-phenylpropan-2-amine |
| SMILES | CCOP(=O)(O)O.CNC(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N.C2H7O4P/c1-9(11-2)8-10-6-4-3-5-7-10;1-2-6-7(3,4)5/h3-7,9,11H,8H2,1-2H3;2H2,1H3,(H2,3,4,5) |
| InChIKey | MRFZBXODUBHWCD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|