C10H15N — CID 44607335
(2S)-1-(2,6-ditritiophenyl)-N-methylpropan-2-amine (PubChem CID 44607335) has the molecular formula C10H15N and a molecular weight of 153.25 g/mol. Its IUPAC name is (2S)-1-(2,6-ditritiophenyl)-N-methylpropan-2-amine.
| Compound Name | (2S)-1-(2,6-ditritiophenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 44607335 |
| Molecular Formula | C10H15N |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | (2S)-1-(2,6-ditritiophenyl)-N-methylpropan-2-amine |
| SMILES | [3H]c1cccc([3H])c1C[C@H](C)NC |
| InChI | InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1/i6T,7T |
| InChIKey | MYWUZJCMWCOHBA-CJTMEMAZSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |