C15H25ClN2 — CID 11971660
N-(1-phenylpropan-2-yl)azepan-1-amine;hydrochloride (PubChem CID 11971660) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is N-(1-phenylpropan-2-yl)azepan-1-amine;hydrochloride.
| Compound Name | N-(1-phenylpropan-2-yl)azepan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 11971660 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-(1-phenylpropan-2-yl)azepan-1-amine;hydrochloride |
| SMILES | CC(Cc1ccccc1)NN1CCCCCC1.Cl |
| InChI | InChI=1S/C15H24N2.ClH/c1-14(13-15-9-5-4-6-10-15)16-17-11-7-2-3-8-12-17;/h4-6,9-10,14,16H,2-3,7-8,11-13H2,1H3;1H |
| InChIKey | VBNKDROJZZUHGM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |