C35H38ClNO2 — CID 70621572
ethyl 4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylate;hydrochloride (PubChem CID 70621572) has the molecular formula C35H38ClNO2 and a molecular weight of 540.15 g/mol. Its IUPAC name is ethyl 4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl 4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70621572 |
| Molecular Formula | C35H38ClNO2 |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | ethyl 4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C35H37NO2.ClH/c1-2-38-33(37)34(29-15-7-3-8-16-29)23-26-36(27-24-34)28-25-35(30-17-9-4-10-18-30,31-19-11-5-12-20-31)32-21-13-6-14-22-32;/h3-22H,2,23-28H2,1H3;1H |
| InChIKey | BRPALSSDJKMXGY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|