C35H37NO5 — CID 70619039
oxalic acid;[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol (PubChem CID 70619039) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is oxalic acid;[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol.
| Compound Name | oxalic acid;[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 70619039 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | oxalic acid;[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol |
| SMILES | O=C(O)C(=O)O.OCC1(c2ccccc2)CCN(CCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H35NO.C2H2O4/c35-27-32(28-13-5-1-6-14-28)21-24-34(25-22-32)26-23-33(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31;3-1(4)2(5)6/h1-20,35H,21-27H2;(H,3,4)(H,5,6) |
| InChIKey | ZWTIYGCRPYKZTF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|