C34H34F3NO — CID 18520141
[4-[4-(trifluoromethyl)phenyl]-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol (PubChem CID 18520141) has the molecular formula C34H34F3NO and a molecular weight of 529.65 g/mol. Its IUPAC name is [4-[4-(trifluoromethyl)phenyl]-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol.
| Compound Name | [4-[4-(trifluoromethyl)phenyl]-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 18520141 |
| Molecular Formula | C34H34F3NO |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | [4-[4-(trifluoromethyl)phenyl]-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanol |
| SMILES | OCC1(c2ccc(C(F)(F)F)cc2)CCN(CCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H34F3NO/c35-34(36,37)31-18-16-27(17-19-31)32(26-39)20-23-38(24-21-32)25-22-33(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-19,39H,20-26H2 |
| InChIKey | VUHVKRZVXOIFGL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|