C23H30ClNO4S — CID 90481494
ethyl 1-[2-(4-methylphenyl)sulfonylethyl]-4-phenylpiperidine-4-carboxylate;hydrochloride (PubChem CID 90481494) has the molecular formula C23H30ClNO4S and a molecular weight of 452.02 g/mol. Its IUPAC name is ethyl 1-[2-(4-methylphenyl)sulfonylethyl]-4-phenylpiperidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[2-(4-methylphenyl)sulfonylethyl]-4-phenylpiperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 90481494 |
| Molecular Formula | C23H30ClNO4S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | ethyl 1-[2-(4-methylphenyl)sulfonylethyl]-4-phenylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCS(=O)(=O)c2ccc(C)cc2)CC1.Cl |
| InChI | InChI=1S/C23H29NO4S.ClH/c1-3-28-22(25)23(20-7-5-4-6-8-20)13-15-24(16-14-23)17-18-29(26,27)21-11-9-19(2)10-12-21;/h4-12H,3,13-18H2,1-2H3;1H |
| InChIKey | WGHXHVNRYFZMGB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |