C20H26Cl2N2O2 — CID 23619800
ethyl 1-(4-aminophenyl)-4-phenylpiperidine-4-carboxylate;dihydrochloride (PubChem CID 23619800) has the molecular formula C20H26Cl2N2O2 and a molecular weight of 397.35 g/mol. Its IUPAC name is ethyl 1-(4-aminophenyl)-4-phenylpiperidine-4-carboxylate;dihydrochloride.
| Compound Name | ethyl 1-(4-aminophenyl)-4-phenylpiperidine-4-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 23619800 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethyl 1-(4-aminophenyl)-4-phenylpiperidine-4-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(c2ccc(N)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H24N2O2.2ClH/c1-2-24-19(23)20(16-6-4-3-5-7-16)12-14-22(15-13-20)18-10-8-17(21)9-11-18;;/h3-11H,2,12-15,21H2,1H3;2*1H |
| InChIKey | PDVCMZYSRLVIFE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|