C20H25N3O2 — CID 97215021
ethyl 1-[(2R)-2,4-dicyanobutyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 97215021) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 1-[(2R)-2,4-dicyanobutyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2R)-2,4-dicyanobutyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 97215021 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | ethyl 1-[(2R)-2,4-dicyanobutyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(C[C@H](C#N)CCC#N)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-25-19(24)20(18-8-4-3-5-9-18)10-13-23(14-11-20)16-17(15-22)7-6-12-21/h3-5,8-9,17H,2,6-7,10-11,13-14,16H2,1H3/t17-/m0/s1 |
| InChIKey | RYAKPSOBZHKTDE-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |