C30H40N2O6 — CID 20838141
(Z)-but-2-enedioic acid;ethyl 1-[2-(diethylamino)-2-phenylethyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 20838141) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;ethyl 1-[2-(diethylamino)-2-phenylethyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | (Z)-but-2-enedioic acid;ethyl 1-[2-(diethylamino)-2-phenylethyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 20838141 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (Z)-but-2-enedioic acid;ethyl 1-[2-(diethylamino)-2-phenylethyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CC(c2ccccc2)N(CC)CC)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H36N2O2.C4H4O4/c1-4-28(5-2)24(22-13-9-7-10-14-22)21-27-19-17-26(18-20-27,25(29)30-6-3)23-15-11-8-12-16-23;5-3(6)1-2-4(7)8/h7-16,24H,4-6,17-21H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ZYUJFMUYBXEZMD-BTJKTKAUSA-N |
| XLogP | 4.38 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|