C39H46N4O6 — CID 67932094
5-O-[2-(4,4-diphenylpiperidin-1-yl)ethyl] 3-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67932094) has the molecular formula C39H46N4O6 and a molecular weight of 666.82 g/mol. Its IUPAC name is 5-O-[2-(4,4-diphenylpiperidin-1-yl)ethyl] 3-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(4,4-diphenylpiperidin-1-yl)ethyl] 3-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67932094 |
| Molecular Formula | C39H46N4O6 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | 5-O-[2-(4,4-diphenylpiperidin-1-yl)ethyl] 3-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCCCOC(=O)C1=C(N)NC(C)=C(C(=O)OCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C39H46N4O6/c1-3-4-5-12-25-48-38(45)35-34(29-14-13-19-32(27-29)43(46)47)33(28(2)41-36(35)40)37(44)49-26-24-42-22-20-39(21-23-42,30-15-8-6-9-16-30)31-17-10-7-11-18-31/h6-11,13-19,27,34,41H,3-5,12,20-26,40H2,1-2H3 |
| InChIKey | CJKDLYNBROTIMC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|