C44H59N3O7 — CID 67823965
(6R)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-5-hexyl-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 67823965) has the molecular formula C44H59N3O7 and a molecular weight of 741.97 g/mol. Its IUPAC name is (6R)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-5-hexyl-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | (6R)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-5-hexyl-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67823965 |
| Molecular Formula | C44H59N3O7 |
| Molecular Weight | 741.97 g/mol |
| Exact Mass | 741.44 |
| IUPAC Name | (6R)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-5-hexyl-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CCCCCCC1(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(CCCOCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)(C(=O)O)C(C)N[C@@H]1C |
| InChI | InChI=1S/C44H59N3O7/c1-4-5-6-13-23-43(40(48)49)33(2)45-34(3)44(41(50)51,39(43)35-17-14-22-38(32-35)47(52)53)24-15-30-54-31-16-27-46-28-25-42(26-29-46,36-18-9-7-10-19-36)37-20-11-8-12-21-37/h7-12,14,17-22,32-34,39,45H,4-6,13,15-16,23-31H2,1-3H3,(H,48,49)(H,50,51)/t33-,34?,39?,43?,44?/m1/s1 |
| InChIKey | SLSSRERITAJSQM-NXMCCSGLSA-N |
| XLogP | 8.44 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.97 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|