C37H45N3O6 — CID 67823875
(6R)-3-[2-(4,4-diphenylpiperidin-1-yl)-2-methylpropyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 67823875) has the molecular formula C37H45N3O6 and a molecular weight of 627.78 g/mol. Its IUPAC name is (6R)-3-[2-(4,4-diphenylpiperidin-1-yl)-2-methylpropyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | (6R)-3-[2-(4,4-diphenylpiperidin-1-yl)-2-methylpropyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67823875 |
| Molecular Formula | C37H45N3O6 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | (6R)-3-[2-(4,4-diphenylpiperidin-1-yl)-2-methylpropyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CC1N[C@H](C)C(C)(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1(CC(C)(C)N1CCC(c2ccccc2)(c2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C37H45N3O6/c1-25-35(5,32(41)42)31(27-13-12-18-30(23-27)40(45)46)37(33(43)44,26(2)38-25)24-34(3,4)39-21-19-36(20-22-39,28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-18,23,25-26,31,38H,19-22,24H2,1-5H3,(H,41,42)(H,43,44)/t25-,26?,31?,35?,37?/m1/s1 |
| InChIKey | RYVPCMDUKZNXDI-YXSYIOSHSA-N |
| XLogP | 6.47 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|