C31H42N4O6 — CID 57168984
3-[3-[4-(2,4-dimethylphenyl)piperazin-1-yl]propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 57168984) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-[3-[4-(2,4-dimethylphenyl)piperazin-1-yl]propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 3-[3-[4-(2,4-dimethylphenyl)piperazin-1-yl]propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57168984 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 3-[3-[4-(2,4-dimethylphenyl)piperazin-1-yl]propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | Cc1ccc(N2CCN(CCCC3(C(=O)O)C(C)NC(C)C(C)(C(=O)O)C3c3cccc([N+](=O)[O-])c3)CC2)c(C)c1 |
| InChI | InChI=1S/C31H42N4O6/c1-20-10-11-26(21(2)18-20)34-16-14-33(15-17-34)13-7-12-31(29(38)39)23(4)32-22(3)30(5,28(36)37)27(31)24-8-6-9-25(19-24)35(40)41/h6,8-11,18-19,22-23,27,32H,7,12-17H2,1-5H3,(H,36,37)(H,38,39) |
| InChIKey | HCHSRRFIQXCQSI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 136.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|