C21H30N2O7 — CID 57271111
3-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-ylpiperidine-3,5-dicarboxylic acid (PubChem CID 57271111) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-ylpiperidine-3,5-dicarboxylic acid.
| Compound Name | 3-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-ylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57271111 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-ylpiperidine-3,5-dicarboxylic acid |
| SMILES | COCCC1(C(=O)O)C(C)NC(C)C(C(=O)O)(C(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H30N2O7/c1-12(2)21(19(26)27)14(4)22-13(3)20(18(24)25,9-10-30-5)17(21)15-7-6-8-16(11-15)23(28)29/h6-8,11-14,17,22H,9-10H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | FJNVXGIXXGRNBL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|