C34H39ClN4O6 — CID 57319632
2-amino-5-[2-[4-(4-chlorophenyl)-4-phenylpiperidin-1-yl]ethyl]-3,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 57319632) has the molecular formula C34H39ClN4O6 and a molecular weight of 635.16 g/mol. Its IUPAC name is 2-amino-5-[2-[4-(4-chlorophenyl)-4-phenylpiperidin-1-yl]ethyl]-3,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-5-[2-[4-(4-chlorophenyl)-4-phenylpiperidin-1-yl]ethyl]-3,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57319632 |
| Molecular Formula | C34H39ClN4O6 |
| Molecular Weight | 635.16 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 2-amino-5-[2-[4-(4-chlorophenyl)-4-phenylpiperidin-1-yl]ethyl]-3,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CC1NC(N)C(C)(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1(CCN1CCC(c2ccccc2)(c2ccc(Cl)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C34H39ClN4O6/c1-22-34(31(42)43,28(32(2,30(40)41)29(36)37-22)23-7-6-10-27(21-23)39(44)45)17-20-38-18-15-33(16-19-38,24-8-4-3-5-9-24)25-11-13-26(35)14-12-25/h3-14,21-22,28-29,37H,15-20,36H2,1-2H3,(H,40,41)(H,42,43) |
| InChIKey | NDCMGUFPFGLSNQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|