C38H43N3O4 — CID 18962996
1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-6-(4,4-diphenylpiperidin-1-yl)hexan-1-one (PubChem CID 18962996) has the molecular formula C38H43N3O4 and a molecular weight of 605.78 g/mol. Its IUPAC name is 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-6-(4,4-diphenylpiperidin-1-yl)hexan-1-one.
| Compound Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-6-(4,4-diphenylpiperidin-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 18962996 |
| Molecular Formula | C38H43N3O4 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-6-(4,4-diphenylpiperidin-1-yl)hexan-1-one |
| SMILES | CC(=O)C1=C(C)NC(C)=C(C(=O)CCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H43N3O4/c1-27-35(29(3)42)37(30-14-13-19-33(26-30)41(44)45)36(28(2)39-27)34(43)20-11-6-12-23-40-24-21-38(22-25-40,31-15-7-4-8-16-31)32-17-9-5-10-18-32/h4-5,7-10,13-19,26,37,39H,6,11-12,20-25H2,1-3H3 |
| InChIKey | VPDMSTUPMJHJBC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|