C30H35N3O6 — CID 77146911
3-O-methyl 5-O-[3-methyl-1-(3-phenylpropyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 77146911) has the molecular formula C30H35N3O6 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-O-methyl 5-O-[3-methyl-1-(3-phenylpropyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[3-methyl-1-(3-phenylpropyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 77146911 |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 3-O-methyl 5-O-[3-methyl-1-(3-phenylpropyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2(C)CCN(CCCc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H35N3O6/c1-20-25(28(34)38-4)27(23-13-8-14-24(18-23)33(36)37)26(21(2)31-20)29(35)39-30(3)15-17-32(19-30)16-9-12-22-10-6-5-7-11-22/h5-8,10-11,13-14,18,27,31H,9,12,15-17,19H2,1-4H3 |
| InChIKey | OXUOMQOKQSYPQU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|