C38H41N3O4 — CID 18962976
1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-5-(4-benzhydrylidenepiperidin-1-yl)pentan-1-one (PubChem CID 18962976) has the molecular formula C38H41N3O4 and a molecular weight of 603.76 g/mol. Its IUPAC name is 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-5-(4-benzhydrylidenepiperidin-1-yl)pentan-1-one.
| Compound Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-5-(4-benzhydrylidenepiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 18962976 |
| Molecular Formula | C38H41N3O4 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]-5-(4-benzhydrylidenepiperidin-1-yl)pentan-1-one |
| SMILES | CC(=O)C1=C(C)NC(C)=C(C(=O)CCCCN2CCC(=C(c3ccccc3)c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H41N3O4/c1-26-35(28(3)42)38(32-17-12-18-33(25-32)41(44)45)36(27(2)39-26)34(43)19-10-11-22-40-23-20-31(21-24-40)37(29-13-6-4-7-14-29)30-15-8-5-9-16-30/h4-9,12-18,25,38-39H,10-11,19-24H2,1-3H3 |
| InChIKey | NGBPDISZLOMAFO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|