C36H43N3O6 — CID 19017600
3-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 19017600) has the molecular formula C36H43N3O6 and a molecular weight of 613.76 g/mol. Its IUPAC name is 3-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 3-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 19017600 |
| Molecular Formula | C36H43N3O6 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | 3-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CC1NC(C)C(CCCN2CCC(c3ccccc3)(c3ccccc3)CC2)(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1(C)C(=O)O |
| InChI | InChI=1S/C36H43N3O6/c1-25-34(3,32(40)41)31(27-12-10-17-30(24-27)39(44)45)36(33(42)43,26(2)37-25)18-11-21-38-22-19-35(20-23-38,28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-10,12-17,24-26,31,37H,11,18-23H2,1-3H3,(H,40,41)(H,42,43) |
| InChIKey | BMMFLOZXFNGTGX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|