C37H45N3O7 — CID 67823869
(6S)-3-[2-(4,4-diphenylpiperidin-1-yl)ethyl]-5-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 67823869) has the molecular formula C37H45N3O7 and a molecular weight of 643.78 g/mol. Its IUPAC name is (6S)-3-[2-(4,4-diphenylpiperidin-1-yl)ethyl]-5-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | (6S)-3-[2-(4,4-diphenylpiperidin-1-yl)ethyl]-5-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67823869 |
| Molecular Formula | C37H45N3O7 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | (6S)-3-[2-(4,4-diphenylpiperidin-1-yl)ethyl]-5-(2-methoxyethyl)-2,6-dimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | COCCC1(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(CCN2CCC(c3ccccc3)(c3ccccc3)CC2)(C(=O)O)C(C)N[C@H]1C |
| InChI | InChI=1S/C37H45N3O7/c1-26-36(33(41)42,19-23-39-21-17-35(18-22-39,29-12-6-4-7-13-29)30-14-8-5-9-15-30)32(28-11-10-16-31(25-28)40(45)46)37(34(43)44,20-24-47-3)27(2)38-26/h4-16,25-27,32,38H,17-24H2,1-3H3,(H,41,42)(H,43,44)/t26?,27-,32?,36?,37?/m0/s1 |
| InChIKey | BTAZCVKZYACPEP-XYTWDUJRSA-N |
| XLogP | 5.71 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|