C30H39N5O9 — CID 57236143
2-amino-3-(1-benzylpiperidin-3-yl)-6-methyl-5-(4-nitrooxybutyl)-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 57236143) has the molecular formula C30H39N5O9 and a molecular weight of 613.67 g/mol. Its IUPAC name is 2-amino-3-(1-benzylpiperidin-3-yl)-6-methyl-5-(4-nitrooxybutyl)-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-3-(1-benzylpiperidin-3-yl)-6-methyl-5-(4-nitrooxybutyl)-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57236143 |
| Molecular Formula | C30H39N5O9 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 2-amino-3-(1-benzylpiperidin-3-yl)-6-methyl-5-(4-nitrooxybutyl)-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CC1NC(N)C(C(=O)O)(C2CCCN(Cc3ccccc3)C2)C(c2cccc([N+](=O)[O-])c2)C1(CCCCO[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C30H39N5O9/c1-20-29(27(36)37,14-5-6-16-44-35(42)43)25(22-11-7-13-24(17-22)34(40)41)30(28(38)39,26(31)32-20)23-12-8-15-33(19-23)18-21-9-3-2-4-10-21/h2-4,7,9-11,13,17,20,23,25-26,32H,5-6,8,12,14-16,18-19,31H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | XXHSKEAOUGJTQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 211.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|