C28H36ClN3O6 — CID 69228164
3-(1-benzylpiperidin-3-yl)-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid;hydrochloride (PubChem CID 69228164) has the molecular formula C28H36ClN3O6 and a molecular weight of 546.06 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-3-yl)-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid;hydrochloride.
| Compound Name | 3-(1-benzylpiperidin-3-yl)-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 69228164 |
| Molecular Formula | C28H36ClN3O6 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 3-(1-benzylpiperidin-3-yl)-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid;hydrochloride |
| SMILES | CC1NC(C)C(C(=O)O)(C2CCCN(Cc3ccccc3)C2)C(c2cccc([N+](=O)[O-])c2)C1(C)C(=O)O.Cl |
| InChI | InChI=1S/C28H35N3O6.ClH/c1-18-27(3,25(32)33)24(21-11-7-13-23(15-21)31(36)37)28(26(34)35,19(2)29-18)22-12-8-14-30(17-22)16-20-9-5-4-6-10-20;/h4-7,9-11,13,15,18-19,22,24,29H,8,12,14,16-17H2,1-3H3,(H,32,33)(H,34,35);1H |
| InChIKey | MMQRMJSBVIKHEM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|