C31H38N3O7P — CID 10483646
(1-benzylpiperidin-3-yl) 5-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 10483646) has the molecular formula C31H38N3O7P and a molecular weight of 595.63 g/mol. Its IUPAC name is (1-benzylpiperidin-3-yl) 5-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | (1-benzylpiperidin-3-yl) 5-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10483646 |
| Molecular Formula | C31H38N3O7P |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (1-benzylpiperidin-3-yl) 5-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCN(Cc3ccccc3)C2)C(c2cccc([N+](=O)[O-])c2)C(P2(=O)OCC(C)(C)CO2)=C(C)N1 |
| InChI | InChI=1S/C31H38N3O7P/c1-21-27(30(35)41-26-14-9-15-33(18-26)17-23-10-6-5-7-11-23)28(24-12-8-13-25(16-24)34(36)37)29(22(2)32-21)42(38)39-19-31(3,4)20-40-42/h5-8,10-13,16,26,28,32H,9,14-15,17-20H2,1-4H3 |
| InChIKey | XNFRLCMFGPFCTB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|