C28H31N3O6 — CID 101371068
5-O-[(3S)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 101371068) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 5-O-[(3S)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(3S)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 101371068 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 5-O-[(3S)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)O[C@H]2CCCN(Cc3ccccc3)C2)[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H31N3O6/c1-18-24(27(32)36-3)26(22-13-7-8-14-23(22)31(34)35)25(19(2)29-18)28(33)37-21-12-9-15-30(17-21)16-20-10-5-4-6-11-20/h4-8,10-11,13-14,21,26,29H,9,12,15-17H2,1-3H3/t21-,26-/m0/s1 |
| InChIKey | KKJDXIPLUDHEPZ-LVXARBLLSA-N |
| XLogP | 4.21 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|