C34H39N5O6S — CID 11764784
3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 11764784) has the molecular formula C34H39N5O6S and a molecular weight of 645.78 g/mol. Its IUPAC name is 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11764784 |
| Molecular Formula | C34H39N5O6S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC2CCCN(Cc3cccs3)C2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCN(C)Cc2ccccc2)=C(N)N1 |
| InChI | InChI=1S/C34H39N5O6S/c1-23-29(34(41)45-27-13-7-15-38(21-27)22-28-14-8-18-46-28)30(25-11-6-12-26(19-25)39(42)43)31(32(35)36-23)33(40)44-17-16-37(2)20-24-9-4-3-5-10-24/h3-6,8-12,14,18-19,27,30,36H,7,13,15-17,20-22,35H2,1-2H3 |
| InChIKey | HINZUNODVNSDAF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|